About 10-nitrobenzo[c][1,8]naphthyridine
10-nitrobenzo[c][1,8]naphthyridine (PubChem CID 141035280) has the molecular formula C12H7N3O2
and a molecular weight of 225.21 g/mol. Its IUPAC name is 10-nitrobenzo[c][1,8]naphthyridine.
Molecular Properties
| Compound Name | 10-nitrobenzo[c][1,8]naphthyridine |
| PubChem CID | 141035280 |
| Molecular Formula | C12H7N3O2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 10-nitrobenzo[c][1,8]naphthyridine |
| SMILES | O=[N+]([O-])c1cccc2cnc3ncccc3c12 |
| InChI | InChI=1S/C12H7N3O2/c16-15(17)10-5-1-3-8-7-14-12-9(11(8)10)4-2-6-13-12/h1-7H |
| InChIKey | KDKLTUYRSFJJSV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 10-nitrobenzo[c][1,8]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-nitrobenzo[c][1,8]naphthyridine?
The IUPAC name of 10-nitrobenzo[c][1,8]naphthyridine (CID 141035280) is 10-nitrobenzo[c][1,8]naphthyridine.
What is the SMILES notation for 10-nitrobenzo[c][1,8]naphthyridine?
The canonical SMILES for 10-nitrobenzo[c][1,8]naphthyridine is O=[N+]([O-])c1cccc2cnc3ncccc3c12.
What is the InChIKey of 10-nitrobenzo[c][1,8]naphthyridine?
The InChIKey is KDKLTUYRSFJJSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O2/c16-15(17)10-5-1-3-8-7-14-12-9(11(8)10)4-2-6-13-12/h1-7H.
What are the key properties of 10-nitrobenzo[c][1,8]naphthyridine?
10-nitrobenzo[c][1,8]naphthyridine has a molecular weight of 225.21 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-nitrobenzo[c][1,8]naphthyridine is sourced from PubChem (CID 141035280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).