About 4-hydroperoxy-3-nitro-1,8-naphthyridine
4-hydroperoxy-3-nitro-1,8-naphthyridine (PubChem CID 22948805) has the molecular formula C8H5N3O4
and a molecular weight of 207.15 g/mol. Its IUPAC name is 4-hydroperoxy-3-nitro-1,8-naphthyridine.
Molecular Properties
| Compound Name | 4-hydroperoxy-3-nitro-1,8-naphthyridine |
| PubChem CID | 22948805 |
| Molecular Formula | C8H5N3O4 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 4-hydroperoxy-3-nitro-1,8-naphthyridine |
| SMILES | O=[N+]([O-])c1cnc2ncccc2c1OO |
| InChI | InChI=1S/C8H5N3O4/c12-11(13)6-4-10-8-5(7(6)15-14)2-1-3-9-8/h1-4,14H |
| InChIKey | IIPGDEWPFMPIFE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroperoxy-3-nitro-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroperoxy-3-nitro-1,8-naphthyridine?
The IUPAC name of 4-hydroperoxy-3-nitro-1,8-naphthyridine (CID 22948805) is 4-hydroperoxy-3-nitro-1,8-naphthyridine.
What is the SMILES notation for 4-hydroperoxy-3-nitro-1,8-naphthyridine?
The canonical SMILES for 4-hydroperoxy-3-nitro-1,8-naphthyridine is O=[N+]([O-])c1cnc2ncccc2c1OO.
What is the InChIKey of 4-hydroperoxy-3-nitro-1,8-naphthyridine?
The InChIKey is IIPGDEWPFMPIFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O4/c12-11(13)6-4-10-8-5(7(6)15-14)2-1-3-9-8/h1-4,14H.
What are the key properties of 4-hydroperoxy-3-nitro-1,8-naphthyridine?
4-hydroperoxy-3-nitro-1,8-naphthyridine has a molecular weight of 207.15 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroperoxy-3-nitro-1,8-naphthyridine is sourced from PubChem (CID 22948805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).