C25H15N3O2 — CID 142726084
15-nitro-2-pyridin-2-yl-2-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),3,5,7,9,11,13,15,17,19-decaene (PubChem CID 142726084) has the molecular formula C25H15N3O2 and a molecular weight of 389.41 g/mol. Its IUPAC name is 15-nitro-2-pyridin-2-yl-2-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),3,5,7,9,11,13,15,17,19-decaene.
| Compound Name | 15-nitro-2-pyridin-2-yl-2-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),3,5,7,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 142726084 |
| Molecular Formula | C25H15N3O2 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 15-nitro-2-pyridin-2-yl-2-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),3,5,7,9,11,13,15,17,19-decaene |
| SMILES | O=[N+]([O-])c1cccc2cc3c4c(cccc4c12)-c1ccccc1N3c1ccccn1 |
| InChI | InChI=1S/C25H15N3O2/c29-28(30)21-12-5-7-16-15-22-25-18(9-6-10-19(25)24(16)21)17-8-1-2-11-20(17)27(22)23-13-3-4-14-26-23/h1-15H |
| InChIKey | CKLZDZNISDTGBY-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|