C40H28N2O2Si — CID 145125947
5-[8-(2-nitrophenyl)naphthalen-1-yl]-10,10-diphenylbenzo[b][1,4]benzazasiline (PubChem CID 145125947) has the molecular formula C40H28N2O2Si and a molecular weight of 596.76 g/mol. Its IUPAC name is 5-[8-(2-nitrophenyl)naphthalen-1-yl]-10,10-diphenylbenzo[b][1,4]benzazasiline.
| Compound Name | 5-[8-(2-nitrophenyl)naphthalen-1-yl]-10,10-diphenylbenzo[b][1,4]benzazasiline |
|---|---|
| PubChem CID | 145125947 |
| Molecular Formula | C40H28N2O2Si |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | 5-[8-(2-nitrophenyl)naphthalen-1-yl]-10,10-diphenylbenzo[b][1,4]benzazasiline |
| SMILES | O=[N+]([O-])c1ccccc1-c1cccc2cccc(N3c4ccccc4[Si](c4ccccc4)(c4ccccc4)c4ccccc43)c12 |
| InChI | InChI=1S/C40H28N2O2Si/c43-42(44)34-23-8-7-21-32(34)33-22-13-15-29-16-14-26-37(40(29)33)41-35-24-9-11-27-38(35)45(30-17-3-1-4-18-30,31-19-5-2-6-20-31)39-28-12-10-25-36(39)41/h1-28H |
| InChIKey | KGIOEPIBVNJDSI-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|