C20H11NO3 — CID 118167285
15-nitro-2-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),3,5,7,9,11,13,15,17,19-decaene (PubChem CID 118167285) has the molecular formula C20H11NO3 and a molecular weight of 313.31 g/mol. Its IUPAC name is 15-nitro-2-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),3,5,7,9,11,13,15,17,19-decaene.
| Compound Name | 15-nitro-2-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),3,5,7,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 118167285 |
| Molecular Formula | C20H11NO3 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 15-nitro-2-oxapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1(21),3,5,7,9,11,13,15,17,19-decaene |
| SMILES | O=[N+]([O-])c1cccc2cc3c4c(cccc4c12)-c1ccccc1O3 |
| InChI | InChI=1S/C20H11NO3/c22-21(23)16-9-3-5-12-11-18-20-14(7-4-8-15(20)19(12)16)13-6-1-2-10-17(13)24-18/h1-11H |
| InChIKey | CHPAZCLCOUIMDD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|