About 5,8-dinitrobenzo[e]pyrene
5,8-dinitrobenzo[e]pyrene (PubChem CID 134693676) has the molecular formula C20H10N2O4
and a molecular weight of 342.31 g/mol. Its IUPAC name is 5,8-dinitrobenzo[e]pyrene.
Molecular Properties
| Compound Name | 5,8-dinitrobenzo[e]pyrene |
| PubChem CID | 134693676 |
| Molecular Formula | C20H10N2O4 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 5,8-dinitrobenzo[e]pyrene |
| SMILES | O=[N+]([O-])c1cc2cccc3c4ccccc4c4c([N+](=O)[O-])ccc1c4c23 |
| InChI | InChI=1S/C20H10N2O4/c23-21(24)16-9-8-15-17(22(25)26)10-11-4-3-7-13-12-5-1-2-6-14(12)19(16)20(15)18(11)13/h1-10H |
| InChIKey | ILNZWUSTMXEYPK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5,8-dinitrobenzo[e]pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dinitrobenzo[e]pyrene?
The IUPAC name of 5,8-dinitrobenzo[e]pyrene (CID 134693676) is 5,8-dinitrobenzo[e]pyrene.
What is the SMILES notation for 5,8-dinitrobenzo[e]pyrene?
The canonical SMILES for 5,8-dinitrobenzo[e]pyrene is O=[N+]([O-])c1cc2cccc3c4ccccc4c4c([N+](=O)[O-])ccc1c4c23.
What is the InChIKey of 5,8-dinitrobenzo[e]pyrene?
The InChIKey is ILNZWUSTMXEYPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10N2O4/c23-21(24)16-9-8-15-17(22(25)26)10-11-4-3-7-13-12-5-1-2-6-14(12)19(16)20(15)18(11)13/h1-10H.
What are the key properties of 5,8-dinitrobenzo[e]pyrene?
5,8-dinitrobenzo[e]pyrene has a molecular weight of 342.31 g/mol, XLogP of 5.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dinitrobenzo[e]pyrene is sourced from PubChem (CID 134693676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).