C26H18N2O8 — CID 175303481
1,7-dinitroperylene;bis(prop-2-enoic acid) (PubChem CID 175303481) has the molecular formula C26H18N2O8 and a molecular weight of 486.44 g/mol. Its IUPAC name is 1,7-dinitroperylene;bis(prop-2-enoic acid).
| Compound Name | 1,7-dinitroperylene;bis(prop-2-enoic acid) |
|---|---|
| PubChem CID | 175303481 |
| Molecular Formula | C26H18N2O8 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 1,7-dinitroperylene;bis(prop-2-enoic acid) |
| SMILES | C=CC(=O)O.C=CC(=O)O.O=[N+]([O-])c1ccc2cccc3c4c([N+](=O)[O-])ccc5cccc(c1c23)c54 |
| InChI | InChI=1S/C20H10N2O4.2C3H4O2/c23-21(24)15-10-8-12-4-2-6-14-18(12)19(15)13-5-1-3-11-7-9-16(22(25)26)20(14)17(11)13;2*1-2-3(4)5/h1-10H;2*2H,1H2,(H,4,5) |
| InChIKey | KRGZELJDFGTLOH-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|