C22H21NO — CID 11278492
N-[2,6-bis(4-methylphenyl)phenyl]acetamide (PubChem CID 11278492) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[2,6-bis(4-methylphenyl)phenyl]acetamide.
| Compound Name | N-[2,6-bis(4-methylphenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 11278492 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-[2,6-bis(4-methylphenyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1c(-c2ccc(C)cc2)cccc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C22H21NO/c1-15-7-11-18(12-8-15)20-5-4-6-21(22(20)23-17(3)24)19-13-9-16(2)10-14-19/h4-14H,1-3H3,(H,23,24) |
| InChIKey | WNYBDSOJXZNLBD-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |