C32H25NO — CID 12729541
4-methyl-N-(2,4,6-triphenylphenyl)benzamide (PubChem CID 12729541) has the molecular formula C32H25NO and a molecular weight of 439.56 g/mol. Its IUPAC name is 4-methyl-N-(2,4,6-triphenylphenyl)benzamide.
| Compound Name | 4-methyl-N-(2,4,6-triphenylphenyl)benzamide |
|---|---|
| PubChem CID | 12729541 |
| Molecular Formula | C32H25NO |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 4-methyl-N-(2,4,6-triphenylphenyl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H25NO/c1-23-17-19-27(20-18-23)32(34)33-31-29(25-13-7-3-8-14-25)21-28(24-11-5-2-6-12-24)22-30(31)26-15-9-4-10-16-26/h2-22H,1H3,(H,33,34) |
| InChIKey | IBYJOAFPEAQXPA-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |