C22H20N2O2 — CID 174942575
3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide (PubChem CID 174942575) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide.
| Compound Name | 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 174942575 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide |
| SMILES | Cc1ccc(-c2ccc(C(N)=O)c(C(N)=O)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O2/c1-13-3-7-15(8-4-13)17-11-12-18(21(23)25)20(22(24)26)19(17)16-9-5-14(2)6-10-16/h3-12H,1-2H3,(H2,23,25)(H2,24,26) |
| InChIKey | INZDHIPIIXSLCH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |