About 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide
3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide (PubChem CID 174942575) has the molecular formula C22H20N2O2
and a molecular weight of 344.41 g/mol. Its IUPAC name is 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide |
| PubChem CID | 174942575 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide |
| SMILES | Cc1ccc(-c2ccc(C(N)=O)c(C(N)=O)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O2/c1-13-3-7-15(8-4-13)17-11-12-18(21(23)25)20(22(24)26)19(17)16-9-5-14(2)6-10-16/h3-12H,1-2H3,(H2,23,25)(H2,24,26) |
| InChIKey | INZDHIPIIXSLCH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide?
The IUPAC name of 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide (CID 174942575) is 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide.
What is the SMILES notation for 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide?
The canonical SMILES for 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide is Cc1ccc(-c2ccc(C(N)=O)c(C(N)=O)c2-c2ccc(C)cc2)cc1.
What is the InChIKey of 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide?
The InChIKey is INZDHIPIIXSLCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O2/c1-13-3-7-15(8-4-13)17-11-12-18(21(23)25)20(22(24)26)19(17)16-9-5-14(2)6-10-16/h3-12H,1-2H3,(H2,23,25)(H2,24,26).
What are the key properties of 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide?
3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide has a molecular weight of 344.41 g/mol, XLogP of 3.84, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(4-methylphenyl)benzene-1,2-dicarboxamide is sourced from PubChem (CID 174942575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).