About 2-bromo-3,5-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide
2-bromo-3,5-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide (PubChem CID 142726441) has the molecular formula C22H19BrN2O4
and a molecular weight of 455.31 g/mol. Its IUPAC name is 2-bromo-3,5-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 2-bromo-3,5-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide |
| PubChem CID | 142726441 |
| Molecular Formula | C22H19BrN2O4 |
| Molecular Weight | 455.31 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 2-bromo-3,5-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide |
| SMILES | COc1ccc(-c2cc(C(N)=O)c(Br)c(-c3ccc(OC)cc3)c2C(N)=O)cc1 |
| InChI | InChI=1S/C22H19BrN2O4/c1-28-14-7-3-12(4-8-14)16-11-17(21(24)26)20(23)18(19(16)22(25)27)13-5-9-15(29-2)10-6-13/h3-11H,1-2H3,(H2,24,26)(H2,25,27) |
| InChIKey | YHWHCNKJVLQQHB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-bromo-3,5-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3,5-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide?
The IUPAC name of 2-bromo-3,5-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide (CID 142726441) is 2-bromo-3,5-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide.
What is the SMILES notation for 2-bromo-3,5-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide?
The canonical SMILES for 2-bromo-3,5-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide is COc1ccc(-c2cc(C(N)=O)c(Br)c(-c3ccc(OC)cc3)c2C(N)=O)cc1.
What is the InChIKey of 2-bromo-3,5-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide?
The InChIKey is YHWHCNKJVLQQHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19BrN2O4/c1-28-14-7-3-12(4-8-14)16-11-17(21(24)26)20(23)18(19(16)22(25)27)13-5-9-15(29-2)10-6-13/h3-11H,1-2H3,(H2,24,26)(H2,25,27).
What are the key properties of 2-bromo-3,5-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide?
2-bromo-3,5-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide has a molecular weight of 455.31 g/mol, XLogP of 4.00, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3,5-bis(4-methoxyphenyl)benzene-1,4-dicarboxamide is sourced from PubChem (CID 142726441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).