C14H13NO4 — CID 82089759
4-(4-methoxyphenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 82089759) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 4-(4-methoxyphenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 82089759 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-(4-methoxyphenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | COc1ccc(-c2cc(C)[nH]c(=O)c2C(=O)O)cc1 |
| InChI | InChI=1S/C14H13NO4/c1-8-7-11(12(14(17)18)13(16)15-8)9-3-5-10(19-2)6-4-9/h3-7H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | WPZHPOZDGMVTLE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |