C23H21NO3 — CID 6270719
3-[(Z)-3-(4-methoxyphenyl)-2-phenylprop-2-enoyl]-4,6-dimethyl-1H-pyridin-2-one (PubChem CID 6270719) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-[(Z)-3-(4-methoxyphenyl)-2-phenylprop-2-enoyl]-4,6-dimethyl-1H-pyridin-2-one.
| Compound Name | 3-[(Z)-3-(4-methoxyphenyl)-2-phenylprop-2-enoyl]-4,6-dimethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 6270719 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 3-[(Z)-3-(4-methoxyphenyl)-2-phenylprop-2-enoyl]-4,6-dimethyl-1H-pyridin-2-one |
| SMILES | COc1ccc(/C=C(\C(=O)c2c(C)cc(C)[nH]c2=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO3/c1-15-13-16(2)24-23(26)21(15)22(25)20(18-7-5-4-6-8-18)14-17-9-11-19(27-3)12-10-17/h4-14H,1-3H3,(H,24,26)/b20-14- |
| InChIKey | PPYSTNMWJLRWGP-ZHZULCJRSA-N |
| XLogP | 4.42 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|