C15H14BrNO2 — CID 68508127
4-bromo-2-[(4-methoxyphenyl)methyl]benzamide (PubChem CID 68508127) has the molecular formula C15H14BrNO2 and a molecular weight of 320.19 g/mol. Its IUPAC name is 4-bromo-2-[(4-methoxyphenyl)methyl]benzamide.
| Compound Name | 4-bromo-2-[(4-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 68508127 |
| Molecular Formula | C15H14BrNO2 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 4-bromo-2-[(4-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(Cc2cc(Br)ccc2C(N)=O)cc1 |
| InChI | InChI=1S/C15H14BrNO2/c1-19-13-5-2-10(3-6-13)8-11-9-12(16)4-7-14(11)15(17)18/h2-7,9H,8H2,1H3,(H2,17,18) |
| InChIKey | MZIYNNVXYGRXIM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |