C17H13BrN2O4S — CID 126394762
S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 5-bromo-2-hydroxybenzenecarbothioate (PubChem CID 126394762) has the molecular formula C17H13BrN2O4S and a molecular weight of 421.27 g/mol. Its IUPAC name is S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 5-bromo-2-hydroxybenzenecarbothioate.
| Compound Name | S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 5-bromo-2-hydroxybenzenecarbothioate |
|---|---|
| PubChem CID | 126394762 |
| Molecular Formula | C17H13BrN2O4S |
| Molecular Weight | 421.27 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 5-bromo-2-hydroxybenzenecarbothioate |
| SMILES | COc1ccc(Cc2nnc(SC(=O)c3cc(Br)ccc3O)o2)cc1 |
| InChI | InChI=1S/C17H13BrN2O4S/c1-23-12-5-2-10(3-6-12)8-15-19-20-17(24-15)25-16(22)13-9-11(18)4-7-14(13)21/h2-7,9,21H,8H2,1H3 |
| InChIKey | CARQPGZSWOFCNW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|