C17H13BrN2O3S — CID 126395773
S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 4-bromobenzenecarbothioate (PubChem CID 126395773) has the molecular formula C17H13BrN2O3S and a molecular weight of 405.27 g/mol. Its IUPAC name is S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 4-bromobenzenecarbothioate.
| Compound Name | S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 4-bromobenzenecarbothioate |
|---|---|
| PubChem CID | 126395773 |
| Molecular Formula | C17H13BrN2O3S |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 4-bromobenzenecarbothioate |
| SMILES | COc1ccc(Cc2nnc(SC(=O)c3ccc(Br)cc3)o2)cc1 |
| InChI | InChI=1S/C17H13BrN2O3S/c1-22-14-8-2-11(3-9-14)10-15-19-20-17(23-15)24-16(21)12-4-6-13(18)7-5-12/h2-9H,10H2,1H3 |
| InChIKey | IBLOUMPWUZJGMH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|