C20H14N2O2S — CID 4036671
S-(5-benzyl-1,3,4-oxadiazol-2-yl) naphthalene-2-carbothioate (PubChem CID 4036671) has the molecular formula C20H14N2O2S and a molecular weight of 346.41 g/mol. Its IUPAC name is S-(5-benzyl-1,3,4-oxadiazol-2-yl) naphthalene-2-carbothioate.
| Compound Name | S-(5-benzyl-1,3,4-oxadiazol-2-yl) naphthalene-2-carbothioate |
|---|---|
| PubChem CID | 4036671 |
| Molecular Formula | C20H14N2O2S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | S-(5-benzyl-1,3,4-oxadiazol-2-yl) naphthalene-2-carbothioate |
| SMILES | O=C(Sc1nnc(Cc2ccccc2)o1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H14N2O2S/c23-19(17-11-10-15-8-4-5-9-16(15)13-17)25-20-22-21-18(24-20)12-14-6-2-1-3-7-14/h1-11,13H,12H2 |
| InChIKey | IAERPLQCNDYOPJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|