About S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-(4-chlorophenyl)ethanethioate
S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-(4-chlorophenyl)ethanethioate (PubChem CID 126395022) has the molecular formula C18H15ClN2O3S
and a molecular weight of 374.85 g/mol. Its IUPAC name is S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-(4-chlorophenyl)ethanethioate.
Molecular Properties
| Compound Name | S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-(4-chlorophenyl)ethanethioate |
| PubChem CID | 126395022 |
| Molecular Formula | C18H15ClN2O3S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-(4-chlorophenyl)ethanethioate |
| SMILES | COc1ccc(Cc2nnc(SC(=O)Cc3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C18H15ClN2O3S/c1-23-15-8-4-12(5-9-15)10-16-20-21-18(24-16)25-17(22)11-13-2-6-14(19)7-3-13/h2-9H,10-11H2,1H3 |
| InChIKey | DBRAPBJAXBWYGY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-(4-chlorophenyl)ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-(4-chlorophenyl)ethanethioate?
The IUPAC name of S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-(4-chlorophenyl)ethanethioate (CID 126395022) is S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-(4-chlorophenyl)ethanethioate.
What is the SMILES notation for S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-(4-chlorophenyl)ethanethioate?
The canonical SMILES for S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-(4-chlorophenyl)ethanethioate is COc1ccc(Cc2nnc(SC(=O)Cc3ccc(Cl)cc3)o2)cc1.
What is the InChIKey of S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-(4-chlorophenyl)ethanethioate?
The InChIKey is DBRAPBJAXBWYGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClN2O3S/c1-23-15-8-4-12(5-9-15)10-16-20-21-18(24-16)25-17(22)11-13-2-6-14(19)7-3-13/h2-9H,10-11H2,1H3.
What are the key properties of S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-(4-chlorophenyl)ethanethioate?
S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-(4-chlorophenyl)ethanethioate has a molecular weight of 374.85 g/mol, XLogP of 4.18, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-[5-[(4-methoxyphenyl)methyl]-1,3,4-oxadiazol-2-yl] 2-(4-chlorophenyl)ethanethioate is sourced from PubChem (CID 126395022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).