C17H11NO2S — CID 143207885
7-phenyl-[1]benzothiolo[3,2-b]furan-2-carboxamide (PubChem CID 143207885) has the molecular formula C17H11NO2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 7-phenyl-[1]benzothiolo[3,2-b]furan-2-carboxamide.
| Compound Name | 7-phenyl-[1]benzothiolo[3,2-b]furan-2-carboxamide |
|---|---|
| PubChem CID | 143207885 |
| Molecular Formula | C17H11NO2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 7-phenyl-[1]benzothiolo[3,2-b]furan-2-carboxamide |
| SMILES | NC(=O)c1cc2sc3ccc(-c4ccccc4)cc3c2o1 |
| InChI | InChI=1S/C17H11NO2S/c18-17(19)13-9-15-16(20-13)12-8-11(6-7-14(12)21-15)10-4-2-1-3-5-10/h1-9H,(H2,18,19) |
| InChIKey | BFXBGPJAMSRLGS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |