C50H32N2OS — CID 70332064
2-[4-[2,8-bis(4-phenylphenyl)dibenzothiophen-4-yl]phenyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 70332064) has the molecular formula C50H32N2OS and a molecular weight of 708.89 g/mol. Its IUPAC name is 2-[4-[2,8-bis(4-phenylphenyl)dibenzothiophen-4-yl]phenyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[4-[2,8-bis(4-phenylphenyl)dibenzothiophen-4-yl]phenyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 70332064 |
| Molecular Formula | C50H32N2OS |
| Molecular Weight | 708.89 g/mol |
| Exact Mass | 708.22 |
| IUPAC Name | 2-[4-[2,8-bis(4-phenylphenyl)dibenzothiophen-4-yl]phenyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2ccc(-c3ccc4sc5c(-c6ccc(-c7nnc(-c8ccccc8)o7)cc6)cc(-c6ccc(-c7ccccc7)cc6)cc5c4c3)cc2)cc1 |
| InChI | InChI=1S/C50H32N2OS/c1-4-10-33(11-5-1)35-16-20-37(21-17-35)42-28-29-47-45(30-42)46-32-43(38-22-18-36(19-23-38)34-12-6-2-7-13-34)31-44(48(46)54-47)39-24-26-41(27-25-39)50-52-51-49(53-50)40-14-8-3-9-15-40/h1-32H |
| InChIKey | APTLCKCDQANVRI-UHFFFAOYSA-N |
| XLogP | 14.11 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.89 |
| LogP ≤ 5 | 14.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |