C56H37N3S — CID 58518659
3-[4-[2,8-bis(3-phenylphenyl)dibenzothiophen-4-yl]phenyl]-4,5-diphenyl-1,2,4-triazole (PubChem CID 58518659) has the molecular formula C56H37N3S and a molecular weight of 784.00 g/mol. Its IUPAC name is 3-[4-[2,8-bis(3-phenylphenyl)dibenzothiophen-4-yl]phenyl]-4,5-diphenyl-1,2,4-triazole.
| Compound Name | 3-[4-[2,8-bis(3-phenylphenyl)dibenzothiophen-4-yl]phenyl]-4,5-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 58518659 |
| Molecular Formula | C56H37N3S |
| Molecular Weight | 784.00 g/mol |
| Exact Mass | 783.27 |
| IUPAC Name | 3-[4-[2,8-bis(3-phenylphenyl)dibenzothiophen-4-yl]phenyl]-4,5-diphenyl-1,2,4-triazole |
| SMILES | c1ccc(-c2cccc(-c3ccc4sc5c(-c6ccc(-c7nnc(-c8ccccc8)n7-c7ccccc7)cc6)cc(-c6cccc(-c7ccccc7)c6)cc5c4c3)c2)cc1 |
| InChI | InChI=1S/C56H37N3S/c1-5-15-38(16-6-1)43-21-13-23-45(33-43)47-31-32-53-51(35-47)52-37-48(46-24-14-22-44(34-46)39-17-7-2-8-18-39)36-50(54(52)60-53)40-27-29-42(30-28-40)56-58-57-55(41-19-9-3-10-20-41)59(56)49-25-11-4-12-26-49/h1-37H |
| InChIKey | LBKPPNQSRFKYRM-UHFFFAOYSA-N |
| XLogP | 15.30 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.00 |
| LogP ≤ 5 | 15.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |