C23H24O2 — CID 175047118
[(1Z,3E)-4-ethyl-2,3-diphenylcycloocta-1,3-dien-1-yl] formate (PubChem CID 175047118) has the molecular formula C23H24O2 and a molecular weight of 332.44 g/mol. Its IUPAC name is [(1Z,3E)-4-ethyl-2,3-diphenylcycloocta-1,3-dien-1-yl] formate.
| Compound Name | [(1Z,3E)-4-ethyl-2,3-diphenylcycloocta-1,3-dien-1-yl] formate |
|---|---|
| PubChem CID | 175047118 |
| Molecular Formula | C23H24O2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | [(1Z,3E)-4-ethyl-2,3-diphenylcycloocta-1,3-dien-1-yl] formate |
| SMILES | CC/C1=C(c2ccccc2)/C(c2ccccc2)=C(/OC=O)CCCC1 |
| InChI | InChI=1S/C23H24O2/c1-2-18-11-9-10-16-21(25-17-24)23(20-14-7-4-8-15-20)22(18)19-12-5-3-6-13-19/h3-8,12-15,17H,2,9-11,16H2,1H3/b22-18-,23-21+ |
| InChIKey | NEXDDQVQRJMQAT-DUJMCHSFSA-N |
| XLogP | 6.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|