C27H28O3 — CID 175048590
4-ethyl-2-naphthalen-1-yl-3-phenylcycloocta-1,3-dien-1-ol;formic acid (PubChem CID 175048590) has the molecular formula C27H28O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-ethyl-2-naphthalen-1-yl-3-phenylcycloocta-1,3-dien-1-ol;formic acid.
| Compound Name | 4-ethyl-2-naphthalen-1-yl-3-phenylcycloocta-1,3-dien-1-ol;formic acid |
|---|---|
| PubChem CID | 175048590 |
| Molecular Formula | C27H28O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 4-ethyl-2-naphthalen-1-yl-3-phenylcycloocta-1,3-dien-1-ol;formic acid |
| SMILES | CCC1=C(c2ccccc2)C(c2cccc3ccccc23)=C(O)CCCC1.O=CO |
| InChI | InChI=1S/C26H26O.CH2O2/c1-2-19-11-7-9-18-24(27)26(25(19)21-13-4-3-5-14-21)23-17-10-15-20-12-6-8-16-22(20)23;2-1-3/h3-6,8,10,12-17,27H,2,7,9,11,18H2,1H3;1H,(H,2,3) |
| InChIKey | BYVYIFZXOBSXAF-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|