C23H18Cl2 — CID 145266499
5,11-dichloro-10-ethyl-8-phenyl-9H-cyclohepta[b]naphthalene (PubChem CID 145266499) has the molecular formula C23H18Cl2 and a molecular weight of 365.30 g/mol. Its IUPAC name is 5,11-dichloro-10-ethyl-8-phenyl-9H-cyclohepta[b]naphthalene.
| Compound Name | 5,11-dichloro-10-ethyl-8-phenyl-9H-cyclohepta[b]naphthalene |
|---|---|
| PubChem CID | 145266499 |
| Molecular Formula | C23H18Cl2 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 5,11-dichloro-10-ethyl-8-phenyl-9H-cyclohepta[b]naphthalene |
| SMILES | CCC1=c2c(Cl)c3ccccc3c(Cl)c2=CC=C(c2ccccc2)C1 |
| InChI | InChI=1S/C23H18Cl2/c1-2-15-14-17(16-8-4-3-5-9-16)12-13-20-21(15)23(25)19-11-7-6-10-18(19)22(20)24/h3-13H,2,14H2,1H3 |
| InChIKey | NMFMCORMGNEYHU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |