C19H22O2 — CID 139254499
(6aS)-4,6a-dimethyl-3-phenyl-4-prop-2-enoxy-5,6-dihydro-1H-pentalen-2-one (PubChem CID 139254499) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is (6aS)-4,6a-dimethyl-3-phenyl-4-prop-2-enoxy-5,6-dihydro-1H-pentalen-2-one.
| Compound Name | (6aS)-4,6a-dimethyl-3-phenyl-4-prop-2-enoxy-5,6-dihydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 139254499 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (6aS)-4,6a-dimethyl-3-phenyl-4-prop-2-enoxy-5,6-dihydro-1H-pentalen-2-one |
| SMILES | C=CCOC1(C)CC[C@@]2(C)CC(=O)C(c3ccccc3)=C12 |
| InChI | InChI=1S/C19H22O2/c1-4-12-21-19(3)11-10-18(2)13-15(20)16(17(18)19)14-8-6-5-7-9-14/h4-9H,1,10-13H2,2-3H3/t18-,19?/m0/s1 |
| InChIKey | HPOXRCYWVPDHHM-OYKVQYDMSA-N |
| XLogP | 4.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|