C18H24O7P2+2 — CID 173226505
1,1'-biphenyl;bis(dihydroxy(oxo)phosphanium);3-prop-2-enoxyprop-1-ene (PubChem CID 173226505) has the molecular formula C18H24O7P2+2 and a molecular weight of 414.33 g/mol. Its IUPAC name is 1,1'-biphenyl;bis(dihydroxy(oxo)phosphanium);3-prop-2-enoxyprop-1-ene.
| Compound Name | 1,1'-biphenyl;bis(dihydroxy(oxo)phosphanium);3-prop-2-enoxyprop-1-ene |
|---|---|
| PubChem CID | 173226505 |
| Molecular Formula | C18H24O7P2+2 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 1,1'-biphenyl;bis(dihydroxy(oxo)phosphanium);3-prop-2-enoxyprop-1-ene |
| SMILES | C=CCOCC=C.O=[P+](O)O.O=[P+](O)O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C6H10O.2HO3P/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-5-7-6-4-2;2*1-4(2)3/h1-10H;3-4H,1-2,5-6H2;2*(H-,1,2,3)/p+2 |
| InChIKey | OLPUNZUXLSERHB-UHFFFAOYSA-P |
| XLogP | 3.99 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|