C26H23Cl — CID 138976563
(9R)-9-(4-chlorophenyl)-9-methyl-7-phenyl-1,2,3,4-tetrahydrofluorene (PubChem CID 138976563) has the molecular formula C26H23Cl and a molecular weight of 370.92 g/mol. Its IUPAC name is (9R)-9-(4-chlorophenyl)-9-methyl-7-phenyl-1,2,3,4-tetrahydrofluorene.
| Compound Name | (9R)-9-(4-chlorophenyl)-9-methyl-7-phenyl-1,2,3,4-tetrahydrofluorene |
|---|---|
| PubChem CID | 138976563 |
| Molecular Formula | C26H23Cl |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (9R)-9-(4-chlorophenyl)-9-methyl-7-phenyl-1,2,3,4-tetrahydrofluorene |
| SMILES | C[C@@]1(c2ccc(Cl)cc2)C2=C(CCCC2)c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C26H23Cl/c1-26(20-12-14-21(27)15-13-20)24-10-6-5-9-22(24)23-16-11-19(17-25(23)26)18-7-3-2-4-8-18/h2-4,7-8,11-17H,5-6,9-10H2,1H3/t26-/m1/s1 |
| InChIKey | JQMZPSDUBKDSQO-AREMUKBSSA-N |
| XLogP | 7.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |