About 1-benzofuran;carbon monoxide;chromium
1-benzofuran;carbon monoxide;chromium (PubChem CID 134899025) has the molecular formula C11H6CrO4
and a molecular weight of 254.16 g/mol. Its IUPAC name is 1-benzofuran;carbon monoxide;chromium.
Molecular Properties
| Compound Name | 1-benzofuran;carbon monoxide;chromium |
| PubChem CID | 134899025 |
| Molecular Formula | C11H6CrO4 |
| Molecular Weight | 254.16 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | 1-benzofuran;carbon monoxide;chromium |
| SMILES | [C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].c1ccc2occc2c1 |
| InChI | InChI=1S/C8H6O.3CO.Cr/c1-2-4-8-7(3-1)5-6-9-8;3*1-2;/h1-6H;;;; |
| InChIKey | OGINUNKAGKGJAA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.16 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran;carbon monoxide;chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran;carbon monoxide;chromium?
The IUPAC name of 1-benzofuran;carbon monoxide;chromium (CID 134899025) is 1-benzofuran;carbon monoxide;chromium.
What is the SMILES notation for 1-benzofuran;carbon monoxide;chromium?
The canonical SMILES for 1-benzofuran;carbon monoxide;chromium is [C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].c1ccc2occc2c1.
What is the InChIKey of 1-benzofuran;carbon monoxide;chromium?
The InChIKey is OGINUNKAGKGJAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.3CO.Cr/c1-2-4-8-7(3-1)5-6-9-8;3*1-2;/h1-6H;;;;.
What are the key properties of 1-benzofuran;carbon monoxide;chromium?
1-benzofuran;carbon monoxide;chromium has a molecular weight of 254.16 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran;carbon monoxide;chromium is sourced from PubChem (CID 134899025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).