About 6-methyl-1-benzofuran;toluene
6-methyl-1-benzofuran;toluene (PubChem CID 156726353) has the molecular formula C16H16O
and a molecular weight of 224.30 g/mol. Its IUPAC name is 6-methyl-1-benzofuran;toluene.
Molecular Properties
| Compound Name | 6-methyl-1-benzofuran;toluene |
| PubChem CID | 156726353 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 6-methyl-1-benzofuran;toluene |
| SMILES | Cc1ccc2ccoc2c1.Cc1ccccc1 |
| InChI | InChI=1S/C9H8O.C7H8/c1-7-2-3-8-4-5-10-9(8)6-7;1-7-5-3-2-4-6-7/h2-6H,1H3;2-6H,1H3 |
| InChIKey | OERNHPNVAACOKF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methyl-1-benzofuran;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1-benzofuran;toluene?
The IUPAC name of 6-methyl-1-benzofuran;toluene (CID 156726353) is 6-methyl-1-benzofuran;toluene.
What is the SMILES notation for 6-methyl-1-benzofuran;toluene?
The canonical SMILES for 6-methyl-1-benzofuran;toluene is Cc1ccc2ccoc2c1.Cc1ccccc1.
What is the InChIKey of 6-methyl-1-benzofuran;toluene?
The InChIKey is OERNHPNVAACOKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.C7H8/c1-7-2-3-8-4-5-10-9(8)6-7;1-7-5-3-2-4-6-7/h2-6H,1H3;2-6H,1H3.
What are the key properties of 6-methyl-1-benzofuran;toluene?
6-methyl-1-benzofuran;toluene has a molecular weight of 224.30 g/mol, XLogP of 4.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1-benzofuran;toluene is sourced from PubChem (CID 156726353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).