About 5-methyl-1-benzofuran;6-methyl-1-benzofuran
5-methyl-1-benzofuran;6-methyl-1-benzofuran (PubChem CID 159816062) has the molecular formula C18H16O2
and a molecular weight of 264.32 g/mol. Its IUPAC name is 5-methyl-1-benzofuran;6-methyl-1-benzofuran.
Molecular Properties
| Compound Name | 5-methyl-1-benzofuran;6-methyl-1-benzofuran |
| PubChem CID | 159816062 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 5-methyl-1-benzofuran;6-methyl-1-benzofuran |
| SMILES | Cc1ccc2ccoc2c1.Cc1ccc2occc2c1 |
| InChI | InChI=1S/2C9H8O/c1-7-2-3-9-8(6-7)4-5-10-9;1-7-2-3-8-4-5-10-9(8)6-7/h2*2-6H,1H3 |
| InChIKey | NLQFIBOWFSJZRB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-1-benzofuran;6-methyl-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-benzofuran;6-methyl-1-benzofuran?
The IUPAC name of 5-methyl-1-benzofuran;6-methyl-1-benzofuran (CID 159816062) is 5-methyl-1-benzofuran;6-methyl-1-benzofuran.
What is the SMILES notation for 5-methyl-1-benzofuran;6-methyl-1-benzofuran?
The canonical SMILES for 5-methyl-1-benzofuran;6-methyl-1-benzofuran is Cc1ccc2ccoc2c1.Cc1ccc2occc2c1.
What is the InChIKey of 5-methyl-1-benzofuran;6-methyl-1-benzofuran?
The InChIKey is NLQFIBOWFSJZRB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H8O/c1-7-2-3-9-8(6-7)4-5-10-9;1-7-2-3-8-4-5-10-9(8)6-7/h2*2-6H,1H3.
What are the key properties of 5-methyl-1-benzofuran;6-methyl-1-benzofuran?
5-methyl-1-benzofuran;6-methyl-1-benzofuran has a molecular weight of 264.32 g/mol, XLogP of 5.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-benzofuran;6-methyl-1-benzofuran is sourced from PubChem (CID 159816062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).