About methane;5-methoxy-1-benzofuran
methane;5-methoxy-1-benzofuran (PubChem CID 160759261) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is methane;5-methoxy-1-benzofuran.
Molecular Properties
| Compound Name | methane;5-methoxy-1-benzofuran |
| PubChem CID | 160759261 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | methane;5-methoxy-1-benzofuran |
| SMILES | C.COc1ccc2occc2c1 |
| InChI | InChI=1S/C9H8O2.CH4/c1-10-8-2-3-9-7(6-8)4-5-11-9;/h2-6H,1H3;1H4 |
| InChIKey | RXVNNYPADMXVCX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;5-methoxy-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;5-methoxy-1-benzofuran?
The IUPAC name of methane;5-methoxy-1-benzofuran (CID 160759261) is methane;5-methoxy-1-benzofuran.
What is the SMILES notation for methane;5-methoxy-1-benzofuran?
The canonical SMILES for methane;5-methoxy-1-benzofuran is C.COc1ccc2occc2c1.
What is the InChIKey of methane;5-methoxy-1-benzofuran?
The InChIKey is RXVNNYPADMXVCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2.CH4/c1-10-8-2-3-9-7(6-8)4-5-11-9;/h2-6H,1H3;1H4.
What are the key properties of methane;5-methoxy-1-benzofuran?
methane;5-methoxy-1-benzofuran has a molecular weight of 164.20 g/mol, XLogP of 3.08, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;5-methoxy-1-benzofuran is sourced from PubChem (CID 160759261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).