C13H12O2 — CID 177430255
5-[(1Z)-3-methoxybuta-1,3-dienyl]-1-benzofuran (PubChem CID 177430255) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 5-[(1Z)-3-methoxybuta-1,3-dienyl]-1-benzofuran.
| Compound Name | 5-[(1Z)-3-methoxybuta-1,3-dienyl]-1-benzofuran |
|---|---|
| PubChem CID | 177430255 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 5-[(1Z)-3-methoxybuta-1,3-dienyl]-1-benzofuran |
| SMILES | C=C(/C=C\c1ccc2occc2c1)OC |
| InChI | InChI=1S/C13H12O2/c1-10(14-2)3-4-11-5-6-13-12(9-11)7-8-15-13/h3-9H,1H2,2H3/b4-3- |
| InChIKey | NAIXCZPAQZBEBF-ARJAWSKDSA-N |
| XLogP | 3.61 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|