About ethane;5-methyl-1-benzofuran;propane
ethane;5-methyl-1-benzofuran;propane (PubChem CID 145107108) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is ethane;5-methyl-1-benzofuran;propane.
Molecular Properties
| Compound Name | ethane;5-methyl-1-benzofuran;propane |
| PubChem CID | 145107108 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | ethane;5-methyl-1-benzofuran;propane |
| SMILES | CC.CCC.Cc1ccc2occc2c1 |
| InChI | InChI=1S/C9H8O.C3H8.C2H6/c1-7-2-3-9-8(6-7)4-5-10-9;1-3-2;1-2/h2-6H,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | NQFFAEHJVNYGBT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;5-methyl-1-benzofuran;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-1-benzofuran;propane?
The IUPAC name of ethane;5-methyl-1-benzofuran;propane (CID 145107108) is ethane;5-methyl-1-benzofuran;propane.
What is the SMILES notation for ethane;5-methyl-1-benzofuran;propane?
The canonical SMILES for ethane;5-methyl-1-benzofuran;propane is CC.CCC.Cc1ccc2occc2c1.
What is the InChIKey of ethane;5-methyl-1-benzofuran;propane?
The InChIKey is NQFFAEHJVNYGBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.C3H8.C2H6/c1-7-2-3-9-8(6-7)4-5-10-9;1-3-2;1-2/h2-6H,1H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;5-methyl-1-benzofuran;propane?
ethane;5-methyl-1-benzofuran;propane has a molecular weight of 206.33 g/mol, XLogP of 5.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-1-benzofuran;propane is sourced from PubChem (CID 145107108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).