About ethyl formate;5-methyl-1-benzofuran
ethyl formate;5-methyl-1-benzofuran (PubChem CID 174830176) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is ethyl formate;5-methyl-1-benzofuran.
Molecular Properties
| Compound Name | ethyl formate;5-methyl-1-benzofuran |
| PubChem CID | 174830176 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | ethyl formate;5-methyl-1-benzofuran |
| SMILES | CCOC=O.Cc1ccc2occc2c1 |
| InChI | InChI=1S/C9H8O.C3H6O2/c1-7-2-3-9-8(6-7)4-5-10-9;1-2-5-3-4/h2-6H,1H3;3H,2H2,1H3 |
| InChIKey | HEWMBKFOBHEGBT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;5-methyl-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;5-methyl-1-benzofuran?
The IUPAC name of ethyl formate;5-methyl-1-benzofuran (CID 174830176) is ethyl formate;5-methyl-1-benzofuran.
What is the SMILES notation for ethyl formate;5-methyl-1-benzofuran?
The canonical SMILES for ethyl formate;5-methyl-1-benzofuran is CCOC=O.Cc1ccc2occc2c1.
What is the InChIKey of ethyl formate;5-methyl-1-benzofuran?
The InChIKey is HEWMBKFOBHEGBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.C3H6O2/c1-7-2-3-9-8(6-7)4-5-10-9;1-2-5-3-4/h2-6H,1H3;3H,2H2,1H3.
What are the key properties of ethyl formate;5-methyl-1-benzofuran?
ethyl formate;5-methyl-1-benzofuran has a molecular weight of 206.24 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;5-methyl-1-benzofuran is sourced from PubChem (CID 174830176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).