C14H14O8 — CID 91125922
2-hydroxy-2-[2-oxo-2-(2-phenylacetyl)oxyethyl]butanedioic acid (PubChem CID 91125922) has the molecular formula C14H14O8 and a molecular weight of 310.26 g/mol. Its IUPAC name is 2-hydroxy-2-[2-oxo-2-(2-phenylacetyl)oxyethyl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[2-oxo-2-(2-phenylacetyl)oxyethyl]butanedioic acid |
|---|---|
| PubChem CID | 91125922 |
| Molecular Formula | C14H14O8 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-hydroxy-2-[2-oxo-2-(2-phenylacetyl)oxyethyl]butanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OC(=O)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H14O8/c15-10(16)7-14(21,13(19)20)8-12(18)22-11(17)6-9-4-2-1-3-5-9/h1-5,21H,6-8H2,(H,15,16)(H,19,20) |
| InChIKey | YKHPLSORFOPWOT-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|