About (2-phenylacetyl) 2-benzyl-2-hydroxy-3-phenylpropanoate
(2-phenylacetyl) 2-benzyl-2-hydroxy-3-phenylpropanoate (PubChem CID 88805859) has the molecular formula C24H22O4
and a molecular weight of 374.44 g/mol. Its IUPAC name is (2-phenylacetyl) 2-benzyl-2-hydroxy-3-phenylpropanoate.
Molecular Properties
| Compound Name | (2-phenylacetyl) 2-benzyl-2-hydroxy-3-phenylpropanoate |
| PubChem CID | 88805859 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (2-phenylacetyl) 2-benzyl-2-hydroxy-3-phenylpropanoate |
| SMILES | O=C(Cc1ccccc1)OC(=O)C(O)(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H22O4/c25-22(16-19-10-4-1-5-11-19)28-23(26)24(27,17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21/h1-15,27H,16-18H2 |
| InChIKey | VQZBSJYGUIDFPA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-phenylacetyl) 2-benzyl-2-hydroxy-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylacetyl) 2-benzyl-2-hydroxy-3-phenylpropanoate?
The IUPAC name of (2-phenylacetyl) 2-benzyl-2-hydroxy-3-phenylpropanoate (CID 88805859) is (2-phenylacetyl) 2-benzyl-2-hydroxy-3-phenylpropanoate.
What is the SMILES notation for (2-phenylacetyl) 2-benzyl-2-hydroxy-3-phenylpropanoate?
The canonical SMILES for (2-phenylacetyl) 2-benzyl-2-hydroxy-3-phenylpropanoate is O=C(Cc1ccccc1)OC(=O)C(O)(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of (2-phenylacetyl) 2-benzyl-2-hydroxy-3-phenylpropanoate?
The InChIKey is VQZBSJYGUIDFPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22O4/c25-22(16-19-10-4-1-5-11-19)28-23(26)24(27,17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21/h1-15,27H,16-18H2.
What are the key properties of (2-phenylacetyl) 2-benzyl-2-hydroxy-3-phenylpropanoate?
(2-phenylacetyl) 2-benzyl-2-hydroxy-3-phenylpropanoate has a molecular weight of 374.44 g/mol, XLogP of 3.52, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylacetyl) 2-benzyl-2-hydroxy-3-phenylpropanoate is sourced from PubChem (CID 88805859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).