C24H22O7S — CID 66598523
2-hydroxy-2-[2-oxo-2-(triphenyl-λ4-sulfanyl)oxyethyl]butanedioic acid (PubChem CID 66598523) has the molecular formula C24H22O7S and a molecular weight of 454.50 g/mol. Its IUPAC name is 2-hydroxy-2-[2-oxo-2-(triphenyl-λ4-sulfanyl)oxyethyl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[2-oxo-2-(triphenyl-λ4-sulfanyl)oxyethyl]butanedioic acid |
|---|---|
| PubChem CID | 66598523 |
| Molecular Formula | C24H22O7S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 2-hydroxy-2-[2-oxo-2-(triphenyl-λ4-sulfanyl)oxyethyl]butanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H22O7S/c25-21(26)16-24(30,23(28)29)17-22(27)31-32(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,30H,16-17H2,(H,25,26)(H,28,29) |
| InChIKey | NZTWRDAEDRLVGP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |