C19H16O7 — CID 174498376
2-[2-(9H-fluoren-9-yloxy)-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 174498376) has the molecular formula C19H16O7 and a molecular weight of 356.33 g/mol. Its IUPAC name is 2-[2-(9H-fluoren-9-yloxy)-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-(9H-fluoren-9-yloxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 174498376 |
| Molecular Formula | C19H16O7 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-[2-(9H-fluoren-9-yloxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C19H16O7/c20-15(21)9-19(25,18(23)24)10-16(22)26-17-13-7-3-1-5-11(13)12-6-2-4-8-14(12)17/h1-8,17,25H,9-10H2,(H,20,21)(H,23,24) |
| InChIKey | JIECXCZHDAJMCF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |