C8H12O9S — CID 87758880
2-(2-ethylsulfonyloxy-2-oxoethyl)-2-hydroxybutanedioic acid (PubChem CID 87758880) has the molecular formula C8H12O9S and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-(2-ethylsulfonyloxy-2-oxoethyl)-2-hydroxybutanedioic acid.
| Compound Name | 2-(2-ethylsulfonyloxy-2-oxoethyl)-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 87758880 |
| Molecular Formula | C8H12O9S |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 2-(2-ethylsulfonyloxy-2-oxoethyl)-2-hydroxybutanedioic acid |
| SMILES | CCS(=O)(=O)OC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12O9S/c1-2-18(15,16)17-6(11)4-8(14,7(12)13)3-5(9)10/h14H,2-4H2,1H3,(H,9,10)(H,12,13) |
| InChIKey | LHNQARZZOVREKK-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|