C10H14O14S — CID 175054839
2-hydroxypropane-1,2,3-tricarboxylic acid;4-oxo-4-sulfooxybutanoic acid (PubChem CID 175054839) has the molecular formula C10H14O14S and a molecular weight of 390.28 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;4-oxo-4-sulfooxybutanoic acid.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;4-oxo-4-sulfooxybutanoic acid |
|---|---|
| PubChem CID | 175054839 |
| Molecular Formula | C10H14O14S |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;4-oxo-4-sulfooxybutanoic acid |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.O=C(O)CCC(=O)OS(=O)(=O)O |
| InChI | InChI=1S/C6H8O7.C4H6O7S/c7-3(8)1-6(13,5(11)12)2-4(9)10;5-3(6)1-2-4(7)11-12(8,9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-2H2,(H,5,6)(H,8,9,10) |
| InChIKey | DILGCVZTCLPADA-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 250.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|