C12H18O18S — CID 157056934
bis(2-hydroxypropane-1,2,3-tricarboxylic acid);sulfuric acid (PubChem CID 157056934) has the molecular formula C12H18O18S and a molecular weight of 482.33 g/mol. Its IUPAC name is bis(2-hydroxypropane-1,2,3-tricarboxylic acid);sulfuric acid.
| Compound Name | bis(2-hydroxypropane-1,2,3-tricarboxylic acid);sulfuric acid |
|---|---|
| PubChem CID | 157056934 |
| Molecular Formula | C12H18O18S |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | bis(2-hydroxypropane-1,2,3-tricarboxylic acid);sulfuric acid |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.O=C(O)CC(O)(CC(=O)O)C(=O)O.O=S(=O)(O)O |
| InChI | InChI=1S/2C6H8O7.H2O4S/c2*7-3(8)1-6(13,5(11)12)2-4(9)10;1-5(2,3)4/h2*13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);(H2,1,2,3,4) |
| InChIKey | AAWDWFNQYQLTDG-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 338.86 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|