C6H9KO11S — CID 158620853
potassium;hydrogen sulfate;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 158620853) has the molecular formula C6H9KO11S and a molecular weight of 328.29 g/mol. Its IUPAC name is potassium;hydrogen sulfate;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | potassium;hydrogen sulfate;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 158620853 |
| Molecular Formula | C6H9KO11S |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | potassium;hydrogen sulfate;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.O=S(=O)([O-])O.[K+] |
| InChI | InChI=1S/C6H8O7.K.H2O4S/c7-3(8)1-6(13,5(11)12)2-4(9)10;;1-5(2,3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;(H2,1,2,3,4)/q;+1;/p-1 |
| InChIKey | HXYWKKRVRINFTQ-UHFFFAOYSA-M |
| XLogP | -5.24 |
| TPSA | 209.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | -5.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|