C6H7AlO11S — CID 88670919
aluminum;3-carboxy-3,5-dihydroxy-5-oxopentanoate;sulfate (PubChem CID 88670919) has the molecular formula C6H7AlO11S and a molecular weight of 314.16 g/mol. Its IUPAC name is aluminum;3-carboxy-3,5-dihydroxy-5-oxopentanoate;sulfate.
| Compound Name | aluminum;3-carboxy-3,5-dihydroxy-5-oxopentanoate;sulfate |
|---|---|
| PubChem CID | 88670919 |
| Molecular Formula | C6H7AlO11S |
| Molecular Weight | 314.16 g/mol |
| Exact Mass | 313.95 |
| IUPAC Name | aluminum;3-carboxy-3,5-dihydroxy-5-oxopentanoate;sulfate |
| SMILES | O=C([O-])CC(O)(CC(=O)O)C(=O)O.O=S(=O)([O-])[O-].[Al+3] |
| InChI | InChI=1S/C6H8O7.Al.H2O4S/c7-3(8)1-6(13,5(11)12)2-4(9)10;;1-5(2,3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;(H2,1,2,3,4)/q;+3;/p-3 |
| InChIKey | OGHFIPRYABQSDK-UHFFFAOYSA-K |
| XLogP | -4.30 |
| TPSA | 215.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.16 |
| LogP ≤ 5 | -4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|