C18H26 — CID 95240086
[(1E,5R)-5,9-dimethyldeca-1,9-dienyl]benzene (PubChem CID 95240086) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is [(1E,5R)-5,9-dimethyldeca-1,9-dienyl]benzene.
| Compound Name | [(1E,5R)-5,9-dimethyldeca-1,9-dienyl]benzene |
|---|---|
| PubChem CID | 95240086 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | [(1E,5R)-5,9-dimethyldeca-1,9-dienyl]benzene |
| SMILES | C=C(C)CCC[C@@H](C)CC/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H26/c1-16(2)10-9-12-17(3)11-7-8-15-18-13-5-4-6-14-18/h4-6,8,13-15,17H,1,7,9-12H2,2-3H3/b15-8+/t17-/m0/s1 |
| InChIKey | BCQUEYYAKXSCBS-BXUGYJKXSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|