C19H26 — CID 134863216
(8,9-dimethyl-6-methylidenedeca-1,8-dienyl)benzene (PubChem CID 134863216) has the molecular formula C19H26 and a molecular weight of 254.42 g/mol. Its IUPAC name is (8,9-dimethyl-6-methylidenedeca-1,8-dienyl)benzene.
| Compound Name | (8,9-dimethyl-6-methylidenedeca-1,8-dienyl)benzene |
|---|---|
| PubChem CID | 134863216 |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | (8,9-dimethyl-6-methylidenedeca-1,8-dienyl)benzene |
| SMILES | C=C(CCCC=Cc1ccccc1)CC(C)=C(C)C |
| InChI | InChI=1S/C19H26/c1-16(2)18(4)15-17(3)11-7-5-8-12-19-13-9-6-10-14-19/h6,8-10,12-14H,3,5,7,11,15H2,1-2,4H3 |
| InChIKey | FBISKDMBBDKEPP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|