C15H22O2 — CID 21423476
[(E)-5,5-diethoxypent-1-enyl]benzene (PubChem CID 21423476) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is [(E)-5,5-diethoxypent-1-enyl]benzene.
| Compound Name | [(E)-5,5-diethoxypent-1-enyl]benzene |
|---|---|
| PubChem CID | 21423476 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | [(E)-5,5-diethoxypent-1-enyl]benzene |
| SMILES | CCOC(CC/C=C/c1ccccc1)OCC |
| InChI | InChI=1S/C15H22O2/c1-3-16-15(17-4-2)13-9-8-12-14-10-6-5-7-11-14/h5-8,10-12,15H,3-4,9,13H2,1-2H3/b12-8+ |
| InChIKey | LBBJKSRSEMJEPF-XYOKQWHBSA-N |
| XLogP | 3.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|