C16H24S — CID 102577338
[(E,5R)-5-butylsulfanylhex-1-enyl]benzene (PubChem CID 102577338) has the molecular formula C16H24S and a molecular weight of 248.44 g/mol. Its IUPAC name is [(E,5R)-5-butylsulfanylhex-1-enyl]benzene.
| Compound Name | [(E,5R)-5-butylsulfanylhex-1-enyl]benzene |
|---|---|
| PubChem CID | 102577338 |
| Molecular Formula | C16H24S |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | [(E,5R)-5-butylsulfanylhex-1-enyl]benzene |
| SMILES | CCCCS[C@H](C)CC/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H24S/c1-3-4-14-17-15(2)10-8-9-13-16-11-6-5-7-12-16/h5-7,9,11-13,15H,3-4,8,10,14H2,1-2H3/b13-9+/t15-/m1/s1 |
| InChIKey | CJHHVBYLHCUCAR-BMQCOBNYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|