C21H29N4O8S2+ — CID 87815770
4-[2-[[methyl-(4-nitrophenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]octane-1,5-disulfonic acid (PubChem CID 87815770) has the molecular formula C21H29N4O8S2+ and a molecular weight of 529.62 g/mol. Its IUPAC name is 4-[2-[[methyl-(4-nitrophenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]octane-1,5-disulfonic acid.
| Compound Name | 4-[2-[[methyl-(4-nitrophenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]octane-1,5-disulfonic acid |
|---|---|
| PubChem CID | 87815770 |
| Molecular Formula | C21H29N4O8S2+ |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 4-[2-[[methyl-(4-nitrophenyl)hydrazinylidene]methyl]pyridin-1-ium-1-yl]octane-1,5-disulfonic acid |
| SMILES | CCCC(C(CCCS(=O)(=O)O)[n+]1ccccc1C=NN(C)c1ccc([N+](=O)[O-])cc1)S(=O)(=O)O |
| InChI | InChI=1S/C21H28N4O8S2/c1-3-7-21(35(31,32)33)20(9-6-15-34(28,29)30)24-14-5-4-8-19(24)16-22-23(2)17-10-12-18(13-11-17)25(26)27/h4-5,8,10-14,16,20-21H,3,6-7,9,15H2,1-2H3,(H-,28,29,30,31,32,33)/p+1 |
| InChIKey | XGIOWGWTBSOBLT-UHFFFAOYSA-O |
| XLogP | 2.62 |
| TPSA | 171.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|