C17H21N5O6S — CID 139820238
3-(2-hydroxy-N-propylanilino)-3-[(5-nitro-2-pyridinyl)diazenyl]propane-1-sulfonic acid (PubChem CID 139820238) has the molecular formula C17H21N5O6S and a molecular weight of 423.45 g/mol. Its IUPAC name is 3-(2-hydroxy-N-propylanilino)-3-[(5-nitro-2-pyridinyl)diazenyl]propane-1-sulfonic acid.
| Compound Name | 3-(2-hydroxy-N-propylanilino)-3-[(5-nitro-2-pyridinyl)diazenyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 139820238 |
| Molecular Formula | C17H21N5O6S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 3-(2-hydroxy-N-propylanilino)-3-[(5-nitro-2-pyridinyl)diazenyl]propane-1-sulfonic acid |
| SMILES | CCCN(c1ccccc1O)C(CCS(=O)(=O)O)/N=N/c1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C17H21N5O6S/c1-2-10-21(14-5-3-4-6-15(14)23)17(9-11-29(26,27)28)20-19-16-8-7-13(12-18-16)22(24)25/h3-8,12,17,23H,2,9-11H2,1H3,(H,26,27,28)/b20-19+ |
| InChIKey | WNINMNLNOMZTOT-FMQUCBEESA-N |
| XLogP | 3.30 |
| TPSA | 158.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|