C15H10N4O4 — CID 136665588
2-[(5-nitro-2-pyridinyl)diazenyl]naphthalene-1,4-diol (PubChem CID 136665588) has the molecular formula C15H10N4O4 and a molecular weight of 310.27 g/mol. Its IUPAC name is 2-[(5-nitro-2-pyridinyl)diazenyl]naphthalene-1,4-diol.
| Compound Name | 2-[(5-nitro-2-pyridinyl)diazenyl]naphthalene-1,4-diol |
|---|---|
| PubChem CID | 136665588 |
| Molecular Formula | C15H10N4O4 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-[(5-nitro-2-pyridinyl)diazenyl]naphthalene-1,4-diol |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2cc(O)c3ccccc3c2O)nc1 |
| InChI | InChI=1S/C15H10N4O4/c20-13-7-12(15(21)11-4-2-1-3-10(11)13)17-18-14-6-5-9(8-16-14)19(22)23/h1-8,20-21H/b18-17+ |
| InChIKey | VRODRWFLHQAQPA-ISLYRVAYSA-N |
| XLogP | 3.97 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|